C6H11F2NO3S — CID 115029011
O-[2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethyl]hydroxylamine (PubChem CID 115029011) has the molecular formula C6H11F2NO3S and a molecular weight of 215.22 g/mol. Its IUPAC name is O-[2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethyl]hydroxylamine.
| Compound Name | O-[2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethyl]hydroxylamine |
|---|---|
| PubChem CID | 115029011 |
| Molecular Formula | C6H11F2NO3S |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | O-[2-(1,1-dioxothiolan-3-yl)-2,2-difluoroethyl]hydroxylamine |
| SMILES | NOCC(F)(F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11F2NO3S/c7-6(8,4-12-9)5-1-2-13(10,11)3-5/h5H,1-4,9H2 |
| InChIKey | PKHHIATZNDOOPC-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|