C9H12N2S — CID 115096003
3-methyl-3,4-dihydro-2H-1,4-benzothiazin-8-amine (PubChem CID 115096003) has the molecular formula C9H12N2S and a molecular weight of 180.28 g/mol. Its IUPAC name is 3-methyl-3,4-dihydro-2H-1,4-benzothiazin-8-amine.
| Compound Name | 3-methyl-3,4-dihydro-2H-1,4-benzothiazin-8-amine |
|---|---|
| PubChem CID | 115096003 |
| Molecular Formula | C9H12N2S |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.07 |
| IUPAC Name | 3-methyl-3,4-dihydro-2H-1,4-benzothiazin-8-amine |
| SMILES | CC1CSc2c(N)cccc2N1 |
| InChI | InChI=1S/C9H12N2S/c1-6-5-12-9-7(10)3-2-4-8(9)11-6/h2-4,6,11H,5,10H2,1H3 |
| InChIKey | NTQAMVAHHNVQNA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|