C11H16N2O2 — CID 115120331
2-amino-3-(2,3-dihydro-1-benzofuran-5-ylamino)propan-1-ol (PubChem CID 115120331) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-amino-3-(2,3-dihydro-1-benzofuran-5-ylamino)propan-1-ol.
| Compound Name | 2-amino-3-(2,3-dihydro-1-benzofuran-5-ylamino)propan-1-ol |
|---|---|
| PubChem CID | 115120331 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-amino-3-(2,3-dihydro-1-benzofuran-5-ylamino)propan-1-ol |
| SMILES | NC(CO)CNc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C11H16N2O2/c12-9(7-14)6-13-10-1-2-11-8(5-10)3-4-15-11/h1-2,5,9,13-14H,3-4,6-7,12H2 |
| InChIKey | ICGREPQKZMBXKP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|