C17H26O7S — CID 11530892
tert-butyl (3R,5S)-3,5-dihydroxy-6-(4-methylphenyl)sulfonyloxyhexanoate (PubChem CID 11530892) has the molecular formula C17H26O7S and a molecular weight of 374.46 g/mol. Its IUPAC name is tert-butyl (3R,5S)-3,5-dihydroxy-6-(4-methylphenyl)sulfonyloxyhexanoate.
| Compound Name | tert-butyl (3R,5S)-3,5-dihydroxy-6-(4-methylphenyl)sulfonyloxyhexanoate |
|---|---|
| PubChem CID | 11530892 |
| Molecular Formula | C17H26O7S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | tert-butyl (3R,5S)-3,5-dihydroxy-6-(4-methylphenyl)sulfonyloxyhexanoate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H](O)C[C@@H](O)CC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H26O7S/c1-12-5-7-15(8-6-12)25(21,22)23-11-14(19)9-13(18)10-16(20)24-17(2,3)4/h5-8,13-14,18-19H,9-11H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | KQJOTSADHOBPCN-KGLIPLIRSA-N |
| XLogP | 1.54 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|