C16H12F2O4 — CID 11536825
3-(2,4-difluorophenoxy)-4,6-dimethoxy-1-benzofuran (PubChem CID 11536825) has the molecular formula C16H12F2O4 and a molecular weight of 306.26 g/mol. Its IUPAC name is 3-(2,4-difluorophenoxy)-4,6-dimethoxy-1-benzofuran.
| Compound Name | 3-(2,4-difluorophenoxy)-4,6-dimethoxy-1-benzofuran |
|---|---|
| PubChem CID | 11536825 |
| Molecular Formula | C16H12F2O4 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 3-(2,4-difluorophenoxy)-4,6-dimethoxy-1-benzofuran |
| SMILES | COc1cc(OC)c2c(Oc3ccc(F)cc3F)coc2c1 |
| InChI | InChI=1S/C16H12F2O4/c1-19-10-6-13(20-2)16-14(7-10)21-8-15(16)22-12-4-3-9(17)5-11(12)18/h3-8H,1-2H3 |
| InChIKey | MKAZJIWYVWSLMS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |