C17H15F2NO4S — CID 167433343
4-(2,4-difluorophenoxy)-1-ethylsulfonyl-6-methoxyindole (PubChem CID 167433343) has the molecular formula C17H15F2NO4S and a molecular weight of 367.37 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-1-ethylsulfonyl-6-methoxyindole.
| Compound Name | 4-(2,4-difluorophenoxy)-1-ethylsulfonyl-6-methoxyindole |
|---|---|
| PubChem CID | 167433343 |
| Molecular Formula | C17H15F2NO4S |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-1-ethylsulfonyl-6-methoxyindole |
| SMILES | CCS(=O)(=O)n1ccc2c(Oc3ccc(F)cc3F)cc(OC)cc21 |
| InChI | InChI=1S/C17H15F2NO4S/c1-3-25(21,22)20-7-6-13-15(20)9-12(23-2)10-17(13)24-16-5-4-11(18)8-14(16)19/h4-10H,3H2,1-2H3 |
| InChIKey | CCUIWKVLHVZIGP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |