C20H16N2O4S — CID 11545378
4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]-3-methylbenzonitrile (PubChem CID 11545378) has the molecular formula C20H16N2O4S and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]-3-methylbenzonitrile.
| Compound Name | 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 11545378 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Oc1ccc2c(c1)OCC[C@H]2C1SC(=O)NC1=O |
| InChI | InChI=1S/C20H16N2O4S/c1-11-8-12(10-21)2-5-16(11)26-13-3-4-14-15(6-7-25-17(14)9-13)18-19(23)22-20(24)27-18/h2-5,8-9,15,18H,6-7H2,1H3,(H,22,23,24)/t15-,18?/m1/s1 |
| InChIKey | MVHSHFMGMFQNQF-NNJIEVJOSA-N |
| XLogP | 3.88 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|