C19H14N2O4S — CID 11610295
4-[[(3S)-3-(2,4-dioxo-1,3-thiazolidin-5-yl)-2,3-dihydro-1-benzofuran-6-yl]oxy]-3-methylbenzonitrile (PubChem CID 11610295) has the molecular formula C19H14N2O4S and a molecular weight of 366.40 g/mol. Its IUPAC name is 4-[[(3S)-3-(2,4-dioxo-1,3-thiazolidin-5-yl)-2,3-dihydro-1-benzofuran-6-yl]oxy]-3-methylbenzonitrile.
| Compound Name | 4-[[(3S)-3-(2,4-dioxo-1,3-thiazolidin-5-yl)-2,3-dihydro-1-benzofuran-6-yl]oxy]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 11610295 |
| Molecular Formula | C19H14N2O4S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-[[(3S)-3-(2,4-dioxo-1,3-thiazolidin-5-yl)-2,3-dihydro-1-benzofuran-6-yl]oxy]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1Oc1ccc2c(c1)OC[C@H]2C1SC(=O)NC1=O |
| InChI | InChI=1S/C19H14N2O4S/c1-10-6-11(8-20)2-5-15(10)25-12-3-4-13-14(9-24-16(13)7-12)17-18(22)21-19(23)26-17/h2-7,14,17H,9H2,1H3,(H,21,22,23)/t14-,17?/m1/s1 |
| InChIKey | DRINATFAHSHHPD-XPCCGILXSA-N |
| XLogP | 3.49 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|