C25H18N2O4S — CID 46852718
4-[[(9R)-9-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-oxatricyclo[8.1.1.03,8]dodeca-3(8),4,6-trien-5-yl]oxy]naphthalene-1-carbonitrile (PubChem CID 46852718) has the molecular formula C25H18N2O4S and a molecular weight of 442.50 g/mol. Its IUPAC name is 4-[[(9R)-9-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-oxatricyclo[8.1.1.03,8]dodeca-3(8),4,6-trien-5-yl]oxy]naphthalene-1-carbonitrile.
| Compound Name | 4-[[(9R)-9-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-oxatricyclo[8.1.1.03,8]dodeca-3(8),4,6-trien-5-yl]oxy]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 46852718 |
| Molecular Formula | C25H18N2O4S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 4-[[(9R)-9-(2,4-dioxo-1,3-thiazolidin-5-yl)-2-oxatricyclo[8.1.1.03,8]dodeca-3(8),4,6-trien-5-yl]oxy]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc3c(c2)OC2CC(C2)[C@H]3C2SC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C25H18N2O4S/c26-12-13-5-8-20(18-4-2-1-3-17(13)18)30-15-6-7-19-21(11-15)31-16-9-14(10-16)22(19)23-24(28)27-25(29)32-23/h1-8,11,14,16,22-23H,9-10H2,(H,27,28,29)/t14?,16?,22-,23?/m1/s1 |
| InChIKey | SBASNAFFGKECCW-WKKOTSFQSA-N |
| XLogP | 5.11 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|