C23H16N2O4S — CID 11604078
4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]naphthalene-1-carbonitrile (PubChem CID 11604078) has the molecular formula C23H16N2O4S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]naphthalene-1-carbonitrile.
| Compound Name | 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]naphthalene-1-carbonitrile |
|---|---|
| PubChem CID | 11604078 |
| Molecular Formula | C23H16N2O4S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 4-[[(4R)-4-(2,4-dioxo-1,3-thiazolidin-5-yl)-3,4-dihydro-2H-chromen-7-yl]oxy]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc3c(c2)OCC[C@H]3C2SC(=O)NC2=O)c2ccccc12 |
| InChI | InChI=1S/C23H16N2O4S/c24-12-13-5-8-19(16-4-2-1-3-15(13)16)29-14-6-7-17-18(9-10-28-20(17)11-14)21-22(26)25-23(27)30-21/h1-8,11,18,21H,9-10H2,(H,25,26,27)/t18-,21?/m1/s1 |
| InChIKey | DKKLMGAFTYAGNU-ITUIMRKVSA-N |
| XLogP | 4.72 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|