C32H24N4O2 — CID 174799936
4-[3-(2-adamantyl)-4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 174799936) has the molecular formula C32H24N4O2 and a molecular weight of 496.57 g/mol. Its IUPAC name is 4-[3-(2-adamantyl)-4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 4-[3-(2-adamantyl)-4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 174799936 |
| Molecular Formula | C32H24N4O2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[3-(2-adamantyl)-4-(3,4-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(Oc3ccc(C#N)c(C#N)c3)c(C3C4CC5CC(C4)CC3C5)c2)cc1C#N |
| InChI | InChI=1S/C32H24N4O2/c33-15-21-1-3-27(12-25(21)17-35)37-29-5-6-31(38-28-4-2-22(16-34)26(13-28)18-36)30(14-29)32-23-8-19-7-20(10-23)11-24(32)9-19/h1-6,12-14,19-20,23-24,32H,7-11H2 |
| InChIKey | PPXLUQALZZBMPV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |