C16H26O4S — CID 11551413
(3R,3aR,4R,6aR)-3-methyl-3-methylsulfanyl-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione (PubChem CID 11551413) has the molecular formula C16H26O4S and a molecular weight of 314.45 g/mol. Its IUPAC name is (3R,3aR,4R,6aR)-3-methyl-3-methylsulfanyl-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione.
| Compound Name | (3R,3aR,4R,6aR)-3-methyl-3-methylsulfanyl-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
|---|---|
| PubChem CID | 11551413 |
| Molecular Formula | C16H26O4S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | (3R,3aR,4R,6aR)-3-methyl-3-methylsulfanyl-4-octyl-4,6a-dihydro-3aH-furo[3,4-b]furan-2,6-dione |
| SMILES | CCCCCCCC[C@H]1OC(=O)[C@@H]2OC(=O)[C@](C)(SC)[C@H]12 |
| InChI | InChI=1S/C16H26O4S/c1-4-5-6-7-8-9-10-11-12-13(14(17)19-11)20-15(18)16(12,2)21-3/h11-13H,4-10H2,1-3H3/t11-,12-,13-,16-/m1/s1 |
| InChIKey | HNKFYCQFQMRXJN-BRXULGCHSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|