C13H16F2N4 — CID 115524023
N-[[4-(difluoromethyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine (PubChem CID 115524023) has the molecular formula C13H16F2N4 and a molecular weight of 266.30 g/mol. Its IUPAC name is N-[[4-(difluoromethyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine.
| Compound Name | N-[[4-(difluoromethyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
|---|---|
| PubChem CID | 115524023 |
| Molecular Formula | C13H16F2N4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | N-[[4-(difluoromethyl)phenyl]methyl]-3-(1H-1,2,4-triazol-5-yl)propan-1-amine |
| SMILES | FC(F)c1ccc(CNCCCc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H16F2N4/c14-13(15)11-5-3-10(4-6-11)8-16-7-1-2-12-17-9-18-19-12/h3-6,9,13,16H,1-2,7-8H2,(H,17,18,19) |
| InChIKey | WEFRVPFSLDWFOM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|