C13H22N4O2S — CID 115599961
6-amino-1-butyl-5-(thian-4-ylamino)pyrimidine-2,4-dione (PubChem CID 115599961) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is 6-amino-1-butyl-5-(thian-4-ylamino)pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-(thian-4-ylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 115599961 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 6-amino-1-butyl-5-(thian-4-ylamino)pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NC2CCSCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H22N4O2S/c1-2-3-6-17-11(14)10(12(18)16-13(17)19)15-9-4-7-20-8-5-9/h9,15H,2-8,14H2,1H3,(H,16,18,19) |
| InChIKey | XTICNPOXZGBCHM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |