C15H26N4O2 — CID 60649267
6-amino-1-butyl-5-[(2-methylcyclohexyl)amino]pyrimidine-2,4-dione (PubChem CID 60649267) has the molecular formula C15H26N4O2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 6-amino-1-butyl-5-[(2-methylcyclohexyl)amino]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-butyl-5-[(2-methylcyclohexyl)amino]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 60649267 |
| Molecular Formula | C15H26N4O2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 6-amino-1-butyl-5-[(2-methylcyclohexyl)amino]pyrimidine-2,4-dione |
| SMILES | CCCCn1c(N)c(NC2CCCCC2C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H26N4O2/c1-3-4-9-19-13(16)12(14(20)18-15(19)21)17-11-8-6-5-7-10(11)2/h10-11,17H,3-9,16H2,1-2H3,(H,18,20,21) |
| InChIKey | PCFCEZLKOCQQKI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |