C23H26N2O9 — CID 11561939
[(2R,3R,4S,5R)-3,4-diacetyloxy-5-(6-hex-1-ynyl-2-oxofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate (PubChem CID 11561939) has the molecular formula C23H26N2O9 and a molecular weight of 474.47 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(6-hex-1-ynyl-2-oxofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(6-hex-1-ynyl-2-oxofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11561939 |
| Molecular Formula | C23H26N2O9 |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4-diacetyloxy-5-(6-hex-1-ynyl-2-oxofuro[2,3-d]pyrimidin-3-yl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCC#Cc1cc2cn([C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]3OC(C)=O)c(=O)nc2o1 |
| InChI | InChI=1S/C23H26N2O9/c1-5-6-7-8-9-17-10-16-11-25(23(29)24-21(16)33-17)22-20(32-15(4)28)19(31-14(3)27)18(34-22)12-30-13(2)26/h10-11,18-20,22H,5-7,12H2,1-4H3/t18-,19-,20+,22-/m1/s1 |
| InChIKey | RCUUYDDGOJIFLZ-XWSHUIEDSA-N |
| XLogP | 1.86 |
| TPSA | 136.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|