C11H14ClN3O3S2 — CID 115632039
2-chloro-N-(3-methylsulfinylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide (PubChem CID 115632039) has the molecular formula C11H14ClN3O3S2 and a molecular weight of 335.84 g/mol. Its IUPAC name is 2-chloro-N-(3-methylsulfinylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(3-methylsulfinylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115632039 |
| Molecular Formula | C11H14ClN3O3S2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2-chloro-N-(3-methylsulfinylpropyl)imidazo[1,2-a]pyridine-3-sulfonamide |
| SMILES | CS(=O)CCCNS(=O)(=O)c1c(Cl)nc2ccccn12 |
| InChI | InChI=1S/C11H14ClN3O3S2/c1-19(16)8-4-6-13-20(17,18)11-10(12)14-9-5-2-3-7-15(9)11/h2-3,5,7,13H,4,6,8H2,1H3 |
| InChIKey | PMIQOVQEEBVZCG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|