C10H16N2S2 — CID 115633744
N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-prop-2-enylsulfanylethanamine (PubChem CID 115633744) has the molecular formula C10H16N2S2 and a molecular weight of 228.39 g/mol. Its IUPAC name is N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-prop-2-enylsulfanylethanamine.
| Compound Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-prop-2-enylsulfanylethanamine |
|---|---|
| PubChem CID | 115633744 |
| Molecular Formula | C10H16N2S2 |
| Molecular Weight | 228.39 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | N-[(4-methyl-1,3-thiazol-2-yl)methyl]-2-prop-2-enylsulfanylethanamine |
| SMILES | C=CCSCCNCc1nc(C)cs1 |
| InChI | InChI=1S/C10H16N2S2/c1-3-5-13-6-4-11-7-10-12-9(2)8-14-10/h3,8,11H,1,4-7H2,2H3 |
| InChIKey | ALUGHUNZRBFHPR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|