C8H15N2+ — CID 11564856
1-butyl-2,4,5-trideuterio-3-methylimidazol-3-ium (PubChem CID 11564856) has the molecular formula C8H15N2+ and a molecular weight of 142.24 g/mol. Its IUPAC name is 1-butyl-2,4,5-trideuterio-3-methylimidazol-3-ium.
| Compound Name | 1-butyl-2,4,5-trideuterio-3-methylimidazol-3-ium |
|---|---|
| PubChem CID | 11564856 |
| Molecular Formula | C8H15N2+ |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 1-butyl-2,4,5-trideuterio-3-methylimidazol-3-ium |
| SMILES | [2H]c1c([2H])[n+](C)c([2H])n1CCCC |
| InChI | InChI=1S/C8H15N2/c1-3-4-5-10-7-6-9(2)8-10/h6-8H,3-5H2,1-2H3/q+1/i6D,7D,8D |
| InChIKey | IQQRAVYLUAZUGX-AYBVGXBASA-N |
| XLogP | 1.11 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|