C15H16O3 — CID 11564997
(1R,2S,5R)-2-[(1S)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 11564997) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is (1R,2S,5R)-2-[(1S)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-3-one.
| Compound Name | (1R,2S,5R)-2-[(1S)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-3-one |
|---|---|
| PubChem CID | 11564997 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (1R,2S,5R)-2-[(1S)-1-phenylethoxy]-8-oxabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | C[C@H](O[C@@H]1C(=O)C[C@@H]2C=C[C@H]1O2)c1ccccc1 |
| InChI | InChI=1S/C15H16O3/c1-10(11-5-3-2-4-6-11)17-15-13(16)9-12-7-8-14(15)18-12/h2-8,10,12,14-15H,9H2,1H3/t10-,12-,14+,15+/m0/s1 |
| InChIKey | QSAXEMQNLMQHIE-OBCWZRDOSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|