C20H26O5 — CID 102377687
[(1S,2S,3R,4R,5R)-3-hydroxy-4-(1-phenylethoxy)-8-oxabicyclo[3.2.1]oct-6-en-2-yl] 2,2-dimethylpropanoate (PubChem CID 102377687) has the molecular formula C20H26O5 and a molecular weight of 346.42 g/mol. Its IUPAC name is [(1S,2S,3R,4R,5R)-3-hydroxy-4-(1-phenylethoxy)-8-oxabicyclo[3.2.1]oct-6-en-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S,3R,4R,5R)-3-hydroxy-4-(1-phenylethoxy)-8-oxabicyclo[3.2.1]oct-6-en-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102377687 |
| Molecular Formula | C20H26O5 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | [(1S,2S,3R,4R,5R)-3-hydroxy-4-(1-phenylethoxy)-8-oxabicyclo[3.2.1]oct-6-en-2-yl] 2,2-dimethylpropanoate |
| SMILES | CC(O[C@@H]1[C@@H](O)[C@H](OC(=O)C(C)(C)C)[C@@H]2C=C[C@H]1O2)c1ccccc1 |
| InChI | InChI=1S/C20H26O5/c1-12(13-8-6-5-7-9-13)23-17-14-10-11-15(24-14)18(16(17)21)25-19(22)20(2,3)4/h5-12,14-18,21H,1-4H3/t12?,14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | BTWYVVVIECXMTF-XAXVOUTHSA-N |
| XLogP | 2.79 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|