C16H23BrO — CID 66344244
1-(3-bromo-2,2-diethylcyclobutyl)oxyethylbenzene (PubChem CID 66344244) has the molecular formula C16H23BrO and a molecular weight of 311.26 g/mol. Its IUPAC name is 1-(3-bromo-2,2-diethylcyclobutyl)oxyethylbenzene.
| Compound Name | 1-(3-bromo-2,2-diethylcyclobutyl)oxyethylbenzene |
|---|---|
| PubChem CID | 66344244 |
| Molecular Formula | C16H23BrO |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(3-bromo-2,2-diethylcyclobutyl)oxyethylbenzene |
| SMILES | CCC1(CC)C(Br)CC1OC(C)c1ccccc1 |
| InChI | InChI=1S/C16H23BrO/c1-4-16(5-2)14(17)11-15(16)18-12(3)13-9-7-6-8-10-13/h6-10,12,14-15H,4-5,11H2,1-3H3 |
| InChIKey | BVSXYYSZGBAFTP-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|