C12H23NO2 — CID 115685959
1-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylpyrrolidine (PubChem CID 115685959) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 1-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylpyrrolidine.
| Compound Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylpyrrolidine |
|---|---|
| PubChem CID | 115685959 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 1-[2-(1,3-dioxan-2-yl)ethyl]-2,4-dimethylpyrrolidine |
| SMILES | CC1CC(C)N(CCC2OCCCO2)C1 |
| InChI | InChI=1S/C12H23NO2/c1-10-8-11(2)13(9-10)5-4-12-14-6-3-7-15-12/h10-12H,3-9H2,1-2H3 |
| InChIKey | PGUZMXFGUOGCTK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |