C15H18Cl2N2O — CID 115776496
(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5,6-dichloro-3-pyridinyl)methanone (PubChem CID 115776496) has the molecular formula C15H18Cl2N2O and a molecular weight of 313.23 g/mol. Its IUPAC name is (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5,6-dichloro-3-pyridinyl)methanone.
| Compound Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5,6-dichloro-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 115776496 |
| Molecular Formula | C15H18Cl2N2O |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | (4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-(5,6-dichloro-3-pyridinyl)methanone |
| SMILES | CC(C)(C)C1=CCN(C(=O)c2cnc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O/c1-15(2,3)11-4-6-19(7-5-11)14(20)10-8-12(16)13(17)18-9-10/h4,8-9H,5-7H2,1-3H3 |
| InChIKey | ZLPRHFJMUZELOI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|