C13H24O3S — CID 115805272
(1,1-dioxothian-2-yl)-(4-methylcyclohexyl)methanol (PubChem CID 115805272) has the molecular formula C13H24O3S and a molecular weight of 260.40 g/mol. Its IUPAC name is (1,1-dioxothian-2-yl)-(4-methylcyclohexyl)methanol.
| Compound Name | (1,1-dioxothian-2-yl)-(4-methylcyclohexyl)methanol |
|---|---|
| PubChem CID | 115805272 |
| Molecular Formula | C13H24O3S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1,1-dioxothian-2-yl)-(4-methylcyclohexyl)methanol |
| SMILES | CC1CCC(C(O)C2CCCCS2(=O)=O)CC1 |
| InChI | InChI=1S/C13H24O3S/c1-10-5-7-11(8-6-10)13(14)12-4-2-3-9-17(12,15)16/h10-14H,2-9H2,1H3 |
| InChIKey | SPRBYRMILDQPMJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |