C13H19NO5S — CID 115902986
N-[1-(hydroxymethyl)cyclobutyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 115902986) has the molecular formula C13H19NO5S and a molecular weight of 301.36 g/mol. Its IUPAC name is N-[1-(hydroxymethyl)cyclobutyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-[1-(hydroxymethyl)cyclobutyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 115902986 |
| Molecular Formula | C13H19NO5S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | N-[1-(hydroxymethyl)cyclobutyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)NC2(CO)CCC2)c1 |
| InChI | InChI=1S/C13H19NO5S/c1-18-10-4-5-11(19-2)12(8-10)20(16,17)14-13(9-15)6-3-7-13/h4-5,8,14-15H,3,6-7,9H2,1-2H3 |
| InChIKey | FNYCOWKPMWHHCL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |