C13H28N2O — CID 115920256
2-(heptan-3-ylamino)-N,N,2-trimethylpropanamide (PubChem CID 115920256) has the molecular formula C13H28N2O and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-(heptan-3-ylamino)-N,N,2-trimethylpropanamide.
| Compound Name | 2-(heptan-3-ylamino)-N,N,2-trimethylpropanamide |
|---|---|
| PubChem CID | 115920256 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 2-(heptan-3-ylamino)-N,N,2-trimethylpropanamide |
| SMILES | CCCCC(CC)NC(C)(C)C(=O)N(C)C |
| InChI | InChI=1S/C13H28N2O/c1-7-9-10-11(8-2)14-13(3,4)12(16)15(5)6/h11,14H,7-10H2,1-6H3 |
| InChIKey | OYWOMPFWFGZODS-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |