C20H28 — CID 11594194
1-[(4E)-3-butyl-4-ethylhepta-1,2,4-trienyl]-4-methylbenzene (PubChem CID 11594194) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 1-[(4E)-3-butyl-4-ethylhepta-1,2,4-trienyl]-4-methylbenzene.
| Compound Name | 1-[(4E)-3-butyl-4-ethylhepta-1,2,4-trienyl]-4-methylbenzene |
|---|---|
| PubChem CID | 11594194 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[(4E)-3-butyl-4-ethylhepta-1,2,4-trienyl]-4-methylbenzene |
| SMILES | CC/C=C(\CC)C(=C=Cc1ccc(C)cc1)CCCC |
| InChI | InChI=1S/C20H28/c1-5-8-10-20(19(7-3)9-6-2)16-15-18-13-11-17(4)12-14-18/h9,11-15H,5-8,10H2,1-4H3/b19-9+ |
| InChIKey | AWUWYAVQXSHKEZ-DJKKODMXSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|