C25H20O3S — CID 11596473
(1R,8S,9S,12S)-10-(4-methylphenyl)sulfonyl-11-phenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene (PubChem CID 11596473) has the molecular formula C25H20O3S and a molecular weight of 400.50 g/mol. Its IUPAC name is (1R,8S,9S,12S)-10-(4-methylphenyl)sulfonyl-11-phenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene.
| Compound Name | (1R,8S,9S,12S)-10-(4-methylphenyl)sulfonyl-11-phenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
|---|---|
| PubChem CID | 11596473 |
| Molecular Formula | C25H20O3S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (1R,8S,9S,12S)-10-(4-methylphenyl)sulfonyl-11-phenyl-13-oxatetracyclo[6.4.1.02,7.09,12]trideca-2,4,6,10-tetraene |
| SMILES | Cc1ccc(S(=O)(=O)C2=C(c3ccccc3)[C@@H]3[C@H]2[C@@H]2O[C@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C25H20O3S/c1-15-11-13-17(14-12-15)29(26,27)25-20(16-7-3-2-4-8-16)21-22(25)24-19-10-6-5-9-18(19)23(21)28-24/h2-14,21-24H,1H3/t21-,22+,23+,24-/m1/s1 |
| InChIKey | HRGBHZNDUYHNSG-NAVOZUGXSA-N |
| XLogP | 5.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |