C19H23NO3S — CID 11609894
2-[[7-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-N-methylethanamine (PubChem CID 11609894) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[[7-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-N-methylethanamine.
| Compound Name | 2-[[7-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-N-methylethanamine |
|---|---|
| PubChem CID | 11609894 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[[7-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]oxy]-N-methylethanamine |
| SMILES | CNCCOC1CCCc2ccc(S(=O)(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C19H23NO3S/c1-20-12-13-23-19-9-5-6-15-10-11-17(14-18(15)19)24(21,22)16-7-3-2-4-8-16/h2-4,7-8,10-11,14,19-20H,5-6,9,12-13H2,1H3 |
| InChIKey | FIHJBNDPFCDFLP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|