C19H21NO2 — CID 11616366
(9R)-3,4-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,13(17),14-hexaene (PubChem CID 11616366) has the molecular formula C19H21NO2 and a molecular weight of 297.37 g/mol. Its IUPAC name is (9R)-3,4-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,13(17),14-hexaene.
| Compound Name | (9R)-3,4-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,13(17),14-hexaene |
|---|---|
| PubChem CID | 11616366 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | (9R)-3,4-dimethoxy-10-methyl-10-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,13(17),14-hexaene |
| SMILES | COc1ccc2c(c1OC)-c1cccc3c1[14C@@H](C2)N(C)CC3 |
| InChI | InChI=1S/C19H21NO2/c1-20-10-9-12-5-4-6-14-17(12)15(20)11-13-7-8-16(21-2)19(22-3)18(13)14/h4-8,15H,9-11H2,1-3H3/t15-/m1/s1/i15+2 |
| InChIKey | HCXDSTXYBRCIQC-QNQYIDBZSA-N |
| XLogP | 3.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |