C22H36O5Si — CID 11625669
triethyl-[[(1R,2R,10R,11R,15R)-10-methoxy-13,13-dimethyl-12,14,16-trioxatetracyclo[8.6.0.02,6.011,15]hexadeca-5,7-dien-2-yl]oxy]silane (PubChem CID 11625669) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is triethyl-[[(1R,2R,10R,11R,15R)-10-methoxy-13,13-dimethyl-12,14,16-trioxatetracyclo[8.6.0.02,6.011,15]hexadeca-5,7-dien-2-yl]oxy]silane.
| Compound Name | triethyl-[[(1R,2R,10R,11R,15R)-10-methoxy-13,13-dimethyl-12,14,16-trioxatetracyclo[8.6.0.02,6.011,15]hexadeca-5,7-dien-2-yl]oxy]silane |
|---|---|
| PubChem CID | 11625669 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | triethyl-[[(1R,2R,10R,11R,15R)-10-methoxy-13,13-dimethyl-12,14,16-trioxatetracyclo[8.6.0.02,6.011,15]hexadeca-5,7-dien-2-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@]12CCC=C1C=CC[C@@]1(OC)[C@H]2O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C22H36O5Si/c1-7-28(8-2,9-3)27-21-14-10-12-16(21)13-11-15-22(23-6)17-18(24-19(21)22)26-20(4,5)25-17/h11-13,17-19H,7-10,14-15H2,1-6H3/t17-,18+,19-,21+,22-/m0/s1 |
| InChIKey | KXFUWRQTRCRWCJ-KAHCOFSNSA-N |
| XLogP | 4.69 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|