C14H25NO5S — CID 116537787
ethyl 2-[(1,1-dioxothian-4-yl)carbamoyl]-3,3-dimethylbutanoate (PubChem CID 116537787) has the molecular formula C14H25NO5S and a molecular weight of 319.42 g/mol. Its IUPAC name is ethyl 2-[(1,1-dioxothian-4-yl)carbamoyl]-3,3-dimethylbutanoate.
| Compound Name | ethyl 2-[(1,1-dioxothian-4-yl)carbamoyl]-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 116537787 |
| Molecular Formula | C14H25NO5S |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | ethyl 2-[(1,1-dioxothian-4-yl)carbamoyl]-3,3-dimethylbutanoate |
| SMILES | CCOC(=O)C(C(=O)NC1CCS(=O)(=O)CC1)C(C)(C)C |
| InChI | InChI=1S/C14H25NO5S/c1-5-20-13(17)11(14(2,3)4)12(16)15-10-6-8-21(18,19)9-7-10/h10-11H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | OVINCCDSSYGVCM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|