C13H25NO5S — CID 116537954
ethyl 3,3-dimethyl-2-(3-methylsulfonylpropylcarbamoyl)butanoate (PubChem CID 116537954) has the molecular formula C13H25NO5S and a molecular weight of 307.41 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(3-methylsulfonylpropylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(3-methylsulfonylpropylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 116537954 |
| Molecular Formula | C13H25NO5S |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(3-methylsulfonylpropylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C13H25NO5S/c1-6-19-12(16)10(13(2,3)4)11(15)14-8-7-9-20(5,17)18/h10H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | DOLXNRLUZXWJLE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|