C12H14N2 — CID 116641422
4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)but-3-yn-1-amine (PubChem CID 116641422) has the molecular formula C12H14N2 and a molecular weight of 186.26 g/mol. Its IUPAC name is 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)but-3-yn-1-amine.
| Compound Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)but-3-yn-1-amine |
|---|---|
| PubChem CID | 116641422 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 4-(6,7-dihydro-5H-cyclopenta[b]pyridin-7-yl)but-3-yn-1-amine |
| SMILES | NCCC#CC1CCc2cccnc21 |
| InChI | InChI=1S/C12H14N2/c13-8-2-1-4-10-6-7-11-5-3-9-14-12(10)11/h3,5,9-10H,2,6-8,13H2 |
| InChIKey | PMQPLRMLHGKNHT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|