C10H12N2S — CID 116646192
6-N,6-N-dimethyl-1-benzothiophene-3,6-diamine (PubChem CID 116646192) has the molecular formula C10H12N2S and a molecular weight of 192.29 g/mol. Its IUPAC name is 6-N,6-N-dimethyl-1-benzothiophene-3,6-diamine.
| Compound Name | 6-N,6-N-dimethyl-1-benzothiophene-3,6-diamine |
|---|---|
| PubChem CID | 116646192 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 6-N,6-N-dimethyl-1-benzothiophene-3,6-diamine |
| SMILES | CN(C)c1ccc2c(N)csc2c1 |
| InChI | InChI=1S/C10H12N2S/c1-12(2)7-3-4-8-9(11)6-13-10(8)5-7/h3-6H,11H2,1-2H3 |
| InChIKey | OONOTYGOBOMKEL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |