C11H20N2OS — CID 116718491
3-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-amine (PubChem CID 116718491) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 3-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-amine.
| Compound Name | 3-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-amine |
|---|---|
| PubChem CID | 116718491 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-methoxy-1-(2-methyl-1,3-thiazol-4-yl)hexan-2-amine |
| SMILES | CCCC(OC)C(N)Cc1csc(C)n1 |
| InChI | InChI=1S/C11H20N2OS/c1-4-5-11(14-3)10(12)6-9-7-15-8(2)13-9/h7,10-11H,4-6,12H2,1-3H3 |
| InChIKey | WIHQNKPCEDPRBU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |