C12H9N3O3S — CID 116787572
5-(3-hydroxyprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-carboxamide (PubChem CID 116787572) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is 5-(3-hydroxyprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-carboxamide.
| Compound Name | 5-(3-hydroxyprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 116787572 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 5-(3-hydroxyprop-1-ynyl)-N-(6-oxo-1H-pyridazin-3-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)c1csc(C#CCO)c1 |
| InChI | InChI=1S/C12H9N3O3S/c16-5-1-2-9-6-8(7-19-9)12(18)13-10-3-4-11(17)15-14-10/h3-4,6-7,16H,5H2,(H,15,17)(H,13,14,18) |
| InChIKey | NFDPENHKTCIMNF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|