C14H15N3O — CID 116787757
6,6-dimethyl-1-pyridazin-3-yl-5,7-dihydroindol-4-one (PubChem CID 116787757) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 6,6-dimethyl-1-pyridazin-3-yl-5,7-dihydroindol-4-one.
| Compound Name | 6,6-dimethyl-1-pyridazin-3-yl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 116787757 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 6,6-dimethyl-1-pyridazin-3-yl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2ccn(-c3cccnn3)c2C1 |
| InChI | InChI=1S/C14H15N3O/c1-14(2)8-11-10(12(18)9-14)5-7-17(11)13-4-3-6-15-16-13/h3-7H,8-9H2,1-2H3 |
| InChIKey | CPDOCKLHIHAKRK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |