C16H23NO2 — CID 62359808
1-(2-hydroxycyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 62359808) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-(2-hydroxycyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(2-hydroxycyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 62359808 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(2-hydroxycyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2ccn(C3CCCCC3O)c2C1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2)9-13-11(15(19)10-16)7-8-17(13)12-5-3-4-6-14(12)18/h7-8,12,14,18H,3-6,9-10H2,1-2H3 |
| InChIKey | NYIAZQPYMCHVLJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |