C17H25NO — CID 55191900
1-(2-cyclopentylethyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 55191900) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(2-cyclopentylethyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(2-cyclopentylethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 55191900 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(2-cyclopentylethyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CC1(C)CC(=O)c2ccn(CCC3CCCC3)c2C1 |
| InChI | InChI=1S/C17H25NO/c1-17(2)11-15-14(16(19)12-17)8-10-18(15)9-7-13-5-3-4-6-13/h8,10,13H,3-7,9,11-12H2,1-2H3 |
| InChIKey | YRHPPGLOJCPGAU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |