C17H27NO — CID 65039119
1-(3-ethylpentan-3-yl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 65039119) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(3-ethylpentan-3-yl)-6,6-dimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(3-ethylpentan-3-yl)-6,6-dimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 65039119 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-(3-ethylpentan-3-yl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CCC(CC)(CC)n1ccc2c1CC(C)(C)CC2=O |
| InChI | InChI=1S/C17H27NO/c1-6-17(7-2,8-3)18-10-9-13-14(18)11-16(4,5)12-15(13)19/h9-10H,6-8,11-12H2,1-5H3 |
| InChIKey | LDYDLQVXBIIQLL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |