C18H27NO — CID 63466947
1-(4-ethylcyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one (PubChem CID 63466947) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 1-(4-ethylcyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one.
| Compound Name | 1-(4-ethylcyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
|---|---|
| PubChem CID | 63466947 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 1-(4-ethylcyclohexyl)-6,6-dimethyl-5,7-dihydroindol-4-one |
| SMILES | CCC1CCC(n2ccc3c2CC(C)(C)CC3=O)CC1 |
| InChI | InChI=1S/C18H27NO/c1-4-13-5-7-14(8-6-13)19-10-9-15-16(19)11-18(2,3)12-17(15)20/h9-10,13-14H,4-8,11-12H2,1-3H3 |
| InChIKey | MWJIXMVLBOIVHM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |