C10H11ClO4S — CID 116866355
1-(6-methyl-1,3-benzodioxol-5-yl)ethanesulfonyl chloride (PubChem CID 116866355) has the molecular formula C10H11ClO4S and a molecular weight of 262.71 g/mol. Its IUPAC name is 1-(6-methyl-1,3-benzodioxol-5-yl)ethanesulfonyl chloride.
| Compound Name | 1-(6-methyl-1,3-benzodioxol-5-yl)ethanesulfonyl chloride |
|---|---|
| PubChem CID | 116866355 |
| Molecular Formula | C10H11ClO4S |
| Molecular Weight | 262.71 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 1-(6-methyl-1,3-benzodioxol-5-yl)ethanesulfonyl chloride |
| SMILES | Cc1cc2c(cc1C(C)S(=O)(=O)Cl)OCO2 |
| InChI | InChI=1S/C10H11ClO4S/c1-6-3-9-10(15-5-14-9)4-8(6)7(2)16(11,12)13/h3-4,7H,5H2,1-2H3 |
| InChIKey | UAZLGSOYEBQSHF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.71 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |