C11H11NO3S — CID 116872920
3-methyl-5-(3-sulfanyloxetan-3-yl)-1,3-benzoxazol-2-one (PubChem CID 116872920) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-methyl-5-(3-sulfanyloxetan-3-yl)-1,3-benzoxazol-2-one.
| Compound Name | 3-methyl-5-(3-sulfanyloxetan-3-yl)-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116872920 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 3-methyl-5-(3-sulfanyloxetan-3-yl)-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(C3(S)COC3)cc21 |
| InChI | InChI=1S/C11H11NO3S/c1-12-8-4-7(11(16)5-14-6-11)2-3-9(8)15-10(12)13/h2-4,16H,5-6H2,1H3 |
| InChIKey | DZSANLUBWNUTMB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|