C11H10ClNO3 — CID 116876549
5-(3-chlorooxetan-3-yl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 116876549) has the molecular formula C11H10ClNO3 and a molecular weight of 239.66 g/mol. Its IUPAC name is 5-(3-chlorooxetan-3-yl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 5-(3-chlorooxetan-3-yl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 116876549 |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.03 |
| IUPAC Name | 5-(3-chlorooxetan-3-yl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2ccc(C3(Cl)COC3)cc21 |
| InChI | InChI=1S/C11H10ClNO3/c1-13-8-4-7(11(12)5-15-6-11)2-3-9(8)16-10(13)14/h2-4H,5-6H2,1H3 |
| InChIKey | LSHSWGWGCRPBBK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|