C12H13BrOS — CID 116876438
3-bromo-3-(3,4-dihydro-2H-thiochromen-6-yl)oxetane (PubChem CID 116876438) has the molecular formula C12H13BrOS and a molecular weight of 285.21 g/mol. Its IUPAC name is 3-bromo-3-(3,4-dihydro-2H-thiochromen-6-yl)oxetane.
| Compound Name | 3-bromo-3-(3,4-dihydro-2H-thiochromen-6-yl)oxetane |
|---|---|
| PubChem CID | 116876438 |
| Molecular Formula | C12H13BrOS |
| Molecular Weight | 285.21 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | 3-bromo-3-(3,4-dihydro-2H-thiochromen-6-yl)oxetane |
| SMILES | BrC1(c2ccc3c(c2)CCCS3)COC1 |
| InChI | InChI=1S/C12H13BrOS/c13-12(7-14-8-12)10-3-4-11-9(6-10)2-1-5-15-11/h3-4,6H,1-2,5,7-8H2 |
| InChIKey | QJHZNVMVNVAUJM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|