C12H14OS — CID 116863508
2-(3,4-dihydro-2H-thiochromen-6-yl)-3-methyloxirane (PubChem CID 116863508) has the molecular formula C12H14OS and a molecular weight of 206.31 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-thiochromen-6-yl)-3-methyloxirane.
| Compound Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)-3-methyloxirane |
|---|---|
| PubChem CID | 116863508 |
| Molecular Formula | C12H14OS |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(3,4-dihydro-2H-thiochromen-6-yl)-3-methyloxirane |
| SMILES | CC1OC1c1ccc2c(c1)CCCS2 |
| InChI | InChI=1S/C12H14OS/c1-8-12(13-8)10-4-5-11-9(7-10)3-2-6-14-11/h4-5,7-8,12H,2-3,6H2,1H3 |
| InChIKey | QHLZYLLWZKFIOU-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|