C16H22O5 — CID 11687938
2-methylpropyl (E)-3-(3-hydroxy-2,4-dimethoxyphenyl)-2-methylprop-2-enoate (PubChem CID 11687938) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-methylpropyl (E)-3-(3-hydroxy-2,4-dimethoxyphenyl)-2-methylprop-2-enoate.
| Compound Name | 2-methylpropyl (E)-3-(3-hydroxy-2,4-dimethoxyphenyl)-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 11687938 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-methylpropyl (E)-3-(3-hydroxy-2,4-dimethoxyphenyl)-2-methylprop-2-enoate |
| SMILES | COc1ccc(/C=C(\C)C(=O)OCC(C)C)c(OC)c1O |
| InChI | InChI=1S/C16H22O5/c1-10(2)9-21-16(18)11(3)8-12-6-7-13(19-4)14(17)15(12)20-5/h6-8,10,17H,9H2,1-5H3/b11-8+ |
| InChIKey | FPEJUQLWWCQNKY-DHZHZOJOSA-N |
| XLogP | 3.01 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|