C18H19ClF16N+ — CID 11693332
(11-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroundecyl)-methyl-bis(prop-2-enyl)azanium (PubChem CID 11693332) has the molecular formula C18H19ClF16N+ and a molecular weight of 588.78 g/mol. Its IUPAC name is (11-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroundecyl)-methyl-bis(prop-2-enyl)azanium.
| Compound Name | (11-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroundecyl)-methyl-bis(prop-2-enyl)azanium |
|---|---|
| PubChem CID | 11693332 |
| Molecular Formula | C18H19ClF16N+ |
| Molecular Weight | 588.78 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | (11-chloro-4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11-hexadecafluoroundecyl)-methyl-bis(prop-2-enyl)azanium |
| SMILES | C=CC[N+](C)(CC=C)CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C18H19ClF16N/c1-4-8-36(3,9-5-2)10-6-7-11(20,21)12(22,23)13(24,25)14(26,27)15(28,29)16(30,31)17(32,33)18(19,34)35/h4-5H,1-2,6-10H2,3H3/q+1 |
| InChIKey | UIRPFVCOHBGXEE-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.78 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|